C24H23FN6O7S — CID 132991435
4-[[4-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]phenyl]methylcarbamoyl]benzenesulfonyl fluoride (PubChem CID 132991435) has the molecular formula C24H23FN6O7S and a molecular weight of 558.55 g/mol. Its IUPAC name is 4-[[4-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]phenyl]methylcarbamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-[[4-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]phenyl]methylcarbamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 132991435 |
| Molecular Formula | C24H23FN6O7S |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | 4-[[4-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]phenyl]methylcarbamoyl]benzenesulfonyl fluoride |
| SMILES | O=C(NCc1ccc(Nc2ncnc3c2ncn3[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1)c1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C24H23FN6O7S/c25-39(36,37)16-7-3-14(4-8-16)23(35)26-9-13-1-5-15(6-2-13)30-21-18-22(28-11-27-21)31(12-29-18)24-20(34)19(33)17(10-32)38-24/h1-8,11-12,17,19-20,24,32-34H,9-10H2,(H,26,35)(H,27,28,30)/t17-,19-,20-,24-/m1/s1 |
| InChIKey | WVBMNXIQPPVVJO-AGFSROSKSA-N |
| XLogP | 0.77 |
| TPSA | 188.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |