C35H33N5 — CID 132991450
4-(12,13,17,18-tetraethyl-21,22-dihydroporphyrin-5-yl)benzonitrile (PubChem CID 132991450) has the molecular formula C35H33N5 and a molecular weight of 523.68 g/mol. Its IUPAC name is 4-(12,13,17,18-tetraethyl-21,22-dihydroporphyrin-5-yl)benzonitrile.
| Compound Name | 4-(12,13,17,18-tetraethyl-21,22-dihydroporphyrin-5-yl)benzonitrile |
|---|---|
| PubChem CID | 132991450 |
| Molecular Formula | C35H33N5 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 4-(12,13,17,18-tetraethyl-21,22-dihydroporphyrin-5-yl)benzonitrile |
| SMILES | CCC1=C(CC)c2cc3ccc([nH]3)c(-c3ccc(C#N)cc3)c3ccc(cc4nc(cc1n2)C(CC)=C4CC)[nH]3 |
| InChI | InChI=1S/C35H33N5/c1-5-25-27(7-3)33-19-34-28(8-4)26(6-2)32(40-34)18-24-14-16-30(38-24)35(22-11-9-21(20-36)10-12-22)29-15-13-23(37-29)17-31(25)39-33/h9-19,37-38H,5-8H2,1-4H3/b23-17-,24-18-,31-17-,32-18-,33-19-,34-19-,35-29-,35-30- |
| InChIKey | VWNWDRQEFDJLIW-OJYKOCMYSA-N |
| XLogP | 9.32 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |