C22H41B2NO4 — CID 132991614
2-[1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]octanenitrile (PubChem CID 132991614) has the molecular formula C22H41B2NO4 and a molecular weight of 405.20 g/mol. Its IUPAC name is 2-[1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]octanenitrile.
| Compound Name | 2-[1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]octanenitrile |
|---|---|
| PubChem CID | 132991614 |
| Molecular Formula | C22H41B2NO4 |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | 2-[1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]octanenitrile |
| SMILES | CCCCCCC(C#N)C(CB1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H41B2NO4/c1-10-11-12-13-14-17(16-25)18(24-28-21(6,7)22(8,9)29-24)15-23-26-19(2,3)20(4,5)27-23/h17-18H,10-15H2,1-9H3 |
| InChIKey | GUXLXZIITWZHHQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|