C22H39B2NO4 — CID 132991619
2-cyclohexyl-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanenitrile (PubChem CID 132991619) has the molecular formula C22H39B2NO4 and a molecular weight of 403.18 g/mol. Its IUPAC name is 2-cyclohexyl-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanenitrile.
| Compound Name | 2-cyclohexyl-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanenitrile |
|---|---|
| PubChem CID | 132991619 |
| Molecular Formula | C22H39B2NO4 |
| Molecular Weight | 403.18 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | 2-cyclohexyl-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanenitrile |
| SMILES | CC1(C)OB(CC(B2OC(C)(C)C(C)(C)O2)C(C#N)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C22H39B2NO4/c1-19(2)20(3,4)27-23(26-19)14-18(17(15-25)16-12-10-9-11-13-16)24-28-21(5,6)22(7,8)29-24/h16-18H,9-14H2,1-8H3 |
| InChIKey | GTTZYLOIRCXFPI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.18 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|