About 5-azido-2,4-dimethoxypyrimidine
5-azido-2,4-dimethoxypyrimidine (PubChem CID 132991782) has the molecular formula C6H7N5O2
and a molecular weight of 181.16 g/mol. Its IUPAC name is 5-azido-2,4-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 5-azido-2,4-dimethoxypyrimidine |
| PubChem CID | 132991782 |
| Molecular Formula | C6H7N5O2 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 5-azido-2,4-dimethoxypyrimidine |
| SMILES | COc1ncc(N=[N+]=[N-])c(OC)n1 |
| InChI | InChI=1S/C6H7N5O2/c1-12-5-4(10-11-7)3-8-6(9-5)13-2/h3H,1-2H3 |
| InChIKey | XFLSRPXPKKCJHJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-2,4-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-2,4-dimethoxypyrimidine?
The IUPAC name of 5-azido-2,4-dimethoxypyrimidine (CID 132991782) is 5-azido-2,4-dimethoxypyrimidine.
What is the SMILES notation for 5-azido-2,4-dimethoxypyrimidine?
The canonical SMILES for 5-azido-2,4-dimethoxypyrimidine is COc1ncc(N=[N+]=[N-])c(OC)n1.
What is the InChIKey of 5-azido-2,4-dimethoxypyrimidine?
The InChIKey is XFLSRPXPKKCJHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O2/c1-12-5-4(10-11-7)3-8-6(9-5)13-2/h3H,1-2H3.
What are the key properties of 5-azido-2,4-dimethoxypyrimidine?
5-azido-2,4-dimethoxypyrimidine has a molecular weight of 181.16 g/mol, XLogP of 1.44, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-2,4-dimethoxypyrimidine is sourced from PubChem (CID 132991782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).