C12H18O2 — CID 132991791
[(1S,2S,4R,5Z)-5-ethylidene-2-bicyclo[2.2.1]heptanyl] propanoate (PubChem CID 132991791) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is [(1S,2S,4R,5Z)-5-ethylidene-2-bicyclo[2.2.1]heptanyl] propanoate.
| Compound Name | [(1S,2S,4R,5Z)-5-ethylidene-2-bicyclo[2.2.1]heptanyl] propanoate |
|---|---|
| PubChem CID | 132991791 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | [(1S,2S,4R,5Z)-5-ethylidene-2-bicyclo[2.2.1]heptanyl] propanoate |
| SMILES | C/C=C1/C[C@@H]2C[C@@H]1C[C@@H]2OC(=O)CC |
| InChI | InChI=1S/C12H18O2/c1-3-8-5-10-6-9(8)7-11(10)14-12(13)4-2/h3,9-11H,4-7H2,1-2H3/b8-3-/t9-,10-,11+/m1/s1 |
| InChIKey | QSWOAKOMZJLMTM-NCJWEAQRSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|