C14H19NO8 — CID 132992100
dimethyl (2R,5R)-2,5-bis(2-methoxy-2-oxoethyl)-1H-pyrrole-2,5-dicarboxylate (PubChem CID 132992100) has the molecular formula C14H19NO8 and a molecular weight of 329.31 g/mol. Its IUPAC name is dimethyl (2R,5R)-2,5-bis(2-methoxy-2-oxoethyl)-1H-pyrrole-2,5-dicarboxylate.
| Compound Name | dimethyl (2R,5R)-2,5-bis(2-methoxy-2-oxoethyl)-1H-pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 132992100 |
| Molecular Formula | C14H19NO8 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | dimethyl (2R,5R)-2,5-bis(2-methoxy-2-oxoethyl)-1H-pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)C[C@]1(C(=O)OC)C=C[C@](CC(=O)OC)(C(=O)OC)N1 |
| InChI | InChI=1S/C14H19NO8/c1-20-9(16)7-13(11(18)22-3)5-6-14(15-13,12(19)23-4)8-10(17)21-2/h5-6,15H,7-8H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | YKKZOMRMLSQWOW-KBPBESRZSA-N |
| XLogP | -0.90 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|