About (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane
(4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane (PubChem CID 132992263) has the molecular formula C27H20N3P
and a molecular weight of 417.45 g/mol. Its IUPAC name is (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane.
Molecular Properties
| Compound Name | (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane |
| PubChem CID | 132992263 |
| Molecular Formula | C27H20N3P |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(P(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C27H20N3P/c1-5-13-21(14-6-1)25-28-26(22-15-7-2-8-16-22)30-27(29-25)31(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | QSZLEKFHUAOJNF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane?
The IUPAC name of (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane (CID 132992263) is (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane.
What is the SMILES notation for (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane?
The canonical SMILES for (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane is c1ccc(-c2nc(-c3ccccc3)nc(P(c3ccccc3)c3ccccc3)n2)cc1.
What is the InChIKey of (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane?
The InChIKey is QSZLEKFHUAOJNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20N3P/c1-5-13-21(14-6-1)25-28-26(22-15-7-2-8-16-22)30-27(29-25)31(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H.
What are the key properties of (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane?
(4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane has a molecular weight of 417.45 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-diphenyl-1,3,5-triazin-2-yl)-diphenylphosphane is sourced from PubChem (CID 132992263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).