About CID 132992635
CID 132992635 (PubChem CID 132992635) has the molecular formula C36H28Cl2N2O2
and a molecular weight of 591.54 g/mol.
Molecular Properties
| Compound Name | CID 132992635 |
| PubChem CID | 132992635 |
| Molecular Formula | C36H28Cl2N2O2 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | — |
| SMILES | CN1C(=O)[C@@]2(c3ccccc31)N1CCC[C@H]1[C@H](c1ccc(Cl)cc1)[C@@]21C(=O)/C(=C/c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C36H28Cl2N2O2/c1-39-30-10-5-4-9-29(30)36(34(39)42)35(32(31-11-6-20-40(31)36)23-14-18-25(38)19-15-23)28-8-3-2-7-26(28)27(33(35)41)21-22-12-16-24(37)17-13-22/h2-5,7-10,12-19,21,31-32H,6,11,20H2,1H3/b27-21+/t31-,32-,35-,36+/m0/s1 |
| InChIKey | LCBVUYCTSDSVBP-IQYJBCKBSA-N |
| XLogP | 7.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 132992635 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 132992635?
The IUPAC name of CID 132992635 (CID 132992635) is not available.
What is the SMILES notation for CID 132992635?
The canonical SMILES for CID 132992635 is CN1C(=O)[C@@]2(c3ccccc31)N1CCC[C@H]1[C@H](c1ccc(Cl)cc1)[C@@]21C(=O)/C(=C/c2ccc(Cl)cc2)c2ccccc21.
What is the InChIKey of CID 132992635?
The InChIKey is LCBVUYCTSDSVBP-IQYJBCKBSA-N. The full InChI is InChI=1S/C36H28Cl2N2O2/c1-39-30-10-5-4-9-29(30)36(34(39)42)35(32(31-11-6-20-40(31)36)23-14-18-25(38)19-15-23)28-8-3-2-7-26(28)27(33(35)41)21-22-12-16-24(37)17-13-22/h2-5,7-10,12-19,21,31-32H,6,11,20H2,1H3/b27-21+/t31-,32-,35-,36+/m0/s1.
What are the key properties of CID 132992635?
CID 132992635 has a molecular weight of 591.54 g/mol, XLogP of 7.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 132992635 is sourced from PubChem (CID 132992635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).