About methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate
methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate (PubChem CID 132992911) has the molecular formula C22H20ClNO4
and a molecular weight of 397.86 g/mol. Its IUPAC name is methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate.
Molecular Properties
| Compound Name | methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate |
| PubChem CID | 132992911 |
| Molecular Formula | C22H20ClNO4 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate |
| SMILES | COC(=O)c1c(O)cc(O)c(Cl)c1CCc1cccnc1Cc1ccccc1 |
| InChI | InChI=1S/C22H20ClNO4/c1-28-22(27)20-16(21(23)19(26)13-18(20)25)10-9-15-8-5-11-24-17(15)12-14-6-3-2-4-7-14/h2-8,11,13,25-26H,9-10,12H2,1H3 |
| InChIKey | XODLEZWUEQKVLO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate?
The IUPAC name of methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate (CID 132992911) is methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate.
What is the SMILES notation for methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate?
The canonical SMILES for methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate is COC(=O)c1c(O)cc(O)c(Cl)c1CCc1cccnc1Cc1ccccc1.
What is the InChIKey of methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate?
The InChIKey is XODLEZWUEQKVLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20ClNO4/c1-28-22(27)20-16(21(23)19(26)13-18(20)25)10-9-15-8-5-11-24-17(15)12-14-6-3-2-4-7-14/h2-8,11,13,25-26H,9-10,12H2,1H3.
What are the key properties of methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate?
methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate has a molecular weight of 397.86 g/mol, XLogP of 4.31, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(2-benzyl-3-pyridinyl)ethyl]-3-chloro-4,6-dihydroxybenzoate is sourced from PubChem (CID 132992911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).