C35H28N4 — CID 132992977
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-methylphenyl)aniline (PubChem CID 132992977) has the molecular formula C35H28N4 and a molecular weight of 504.64 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-methylphenyl)aniline.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 132992977 |
| Molecular Formula | C35H28N4 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-methylphenyl)aniline |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccccc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C35H28N4/c1-25-17-21-29(22-18-25)39(30-23-19-26(2)20-24-30)32-16-10-9-15-31(32)35-37-33(27-11-5-3-6-12-27)36-34(38-35)28-13-7-4-8-14-28/h3-24H,1-2H3 |
| InChIKey | QMTHPJNMRRACEO-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |