About 4,5-diethynyl-1,2,3-benzothiadiazole
4,5-diethynyl-1,2,3-benzothiadiazole (PubChem CID 132993019) has the molecular formula C10H4N2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is 4,5-diethynyl-1,2,3-benzothiadiazole.
Molecular Properties
| Compound Name | 4,5-diethynyl-1,2,3-benzothiadiazole |
| PubChem CID | 132993019 |
| Molecular Formula | C10H4N2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 4,5-diethynyl-1,2,3-benzothiadiazole |
| SMILES | C#Cc1ccc2snnc2c1C#C |
| InChI | InChI=1S/C10H4N2S/c1-3-7-5-6-9-10(8(7)4-2)11-12-13-9/h1-2,5-6H |
| InChIKey | GYDZWPUTFOKITA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diethynyl-1,2,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethynyl-1,2,3-benzothiadiazole?
The IUPAC name of 4,5-diethynyl-1,2,3-benzothiadiazole (CID 132993019) is 4,5-diethynyl-1,2,3-benzothiadiazole.
What is the SMILES notation for 4,5-diethynyl-1,2,3-benzothiadiazole?
The canonical SMILES for 4,5-diethynyl-1,2,3-benzothiadiazole is C#Cc1ccc2snnc2c1C#C.
What is the InChIKey of 4,5-diethynyl-1,2,3-benzothiadiazole?
The InChIKey is GYDZWPUTFOKITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4N2S/c1-3-7-5-6-9-10(8(7)4-2)11-12-13-9/h1-2,5-6H.
What are the key properties of 4,5-diethynyl-1,2,3-benzothiadiazole?
4,5-diethynyl-1,2,3-benzothiadiazole has a molecular weight of 184.22 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethynyl-1,2,3-benzothiadiazole is sourced from PubChem (CID 132993019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).