About 6-bromo-2-methyl-4H-3,1-benzoxazine
6-bromo-2-methyl-4H-3,1-benzoxazine (PubChem CID 132993150) has the molecular formula C9H8BrNO
and a molecular weight of 226.07 g/mol. Its IUPAC name is 6-bromo-2-methyl-4H-3,1-benzoxazine.
Molecular Properties
| Compound Name | 6-bromo-2-methyl-4H-3,1-benzoxazine |
| PubChem CID | 132993150 |
| Molecular Formula | C9H8BrNO |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 6-bromo-2-methyl-4H-3,1-benzoxazine |
| SMILES | CC1=Nc2ccc(Br)cc2CO1 |
| InChI | InChI=1S/C9H8BrNO/c1-6-11-9-3-2-8(10)4-7(9)5-12-6/h2-4H,5H2,1H3 |
| InChIKey | RDZAGXASXMIPSX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-2-methyl-4H-3,1-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-methyl-4H-3,1-benzoxazine?
The IUPAC name of 6-bromo-2-methyl-4H-3,1-benzoxazine (CID 132993150) is 6-bromo-2-methyl-4H-3,1-benzoxazine.
What is the SMILES notation for 6-bromo-2-methyl-4H-3,1-benzoxazine?
The canonical SMILES for 6-bromo-2-methyl-4H-3,1-benzoxazine is CC1=Nc2ccc(Br)cc2CO1.
What is the InChIKey of 6-bromo-2-methyl-4H-3,1-benzoxazine?
The InChIKey is RDZAGXASXMIPSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO/c1-6-11-9-3-2-8(10)4-7(9)5-12-6/h2-4H,5H2,1H3.
What are the key properties of 6-bromo-2-methyl-4H-3,1-benzoxazine?
6-bromo-2-methyl-4H-3,1-benzoxazine has a molecular weight of 226.07 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-methyl-4H-3,1-benzoxazine is sourced from PubChem (CID 132993150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).