C11H16OS2 — CID 132993217
3-[1-(1,3-dithiolan-2-ylidene)ethyl]cyclohexan-1-one (PubChem CID 132993217) has the molecular formula C11H16OS2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-[1-(1,3-dithiolan-2-ylidene)ethyl]cyclohexan-1-one.
| Compound Name | 3-[1-(1,3-dithiolan-2-ylidene)ethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 132993217 |
| Molecular Formula | C11H16OS2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3-[1-(1,3-dithiolan-2-ylidene)ethyl]cyclohexan-1-one |
| SMILES | CC(=C1SCCS1)C1CCCC(=O)C1 |
| InChI | InChI=1S/C11H16OS2/c1-8(11-13-5-6-14-11)9-3-2-4-10(12)7-9/h9H,2-7H2,1H3 |
| InChIKey | ZCSYABZYYYQJDH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |