C25H44N2 — CID 132993812
1-methyl-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazine (PubChem CID 132993812) has the molecular formula C25H44N2 and a molecular weight of 372.64 g/mol. Its IUPAC name is 1-methyl-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazine.
| Compound Name | 1-methyl-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazine |
|---|---|
| PubChem CID | 132993812 |
| Molecular Formula | C25H44N2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.35 |
| IUPAC Name | 1-methyl-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCN1CCN(C)CC1 |
| InChI | InChI=1S/C25H44N2/c1-22(2)10-7-11-23(3)12-8-13-24(4)14-9-15-25(5)16-17-27-20-18-26(6)19-21-27/h10,12,14,16H,7-9,11,13,15,17-21H2,1-6H3 |
| InChIKey | RNYWGZFGJLZKNY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|