C55H110O4 — CID 132993935
2,3-bis(3,7,11,15,19-pentamethylicosoxy)propyl acetate (PubChem CID 132993935) has the molecular formula C55H110O4 and a molecular weight of 835.48 g/mol. Its IUPAC name is 2,3-bis(3,7,11,15,19-pentamethylicosoxy)propyl acetate.
| Compound Name | 2,3-bis(3,7,11,15,19-pentamethylicosoxy)propyl acetate |
|---|---|
| PubChem CID | 132993935 |
| Molecular Formula | C55H110O4 |
| Molecular Weight | 835.48 g/mol |
| Exact Mass | 834.84 |
| IUPAC Name | 2,3-bis(3,7,11,15,19-pentamethylicosoxy)propyl acetate |
| SMILES | CC(=O)OCC(COCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)C)OCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C55H110O4/c1-44(2)22-14-24-46(5)26-16-28-48(7)30-18-32-50(9)34-20-36-52(11)38-40-57-42-55(43-59-54(13)56)58-41-39-53(12)37-21-35-51(10)33-19-31-49(8)29-17-27-47(6)25-15-23-45(3)4/h44-53,55H,14-43H2,1-13H3 |
| InChIKey | JVQLKIMAYJXGOV-UHFFFAOYSA-N |
| XLogP | 17.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.48 |
| LogP ≤ 5 | 17.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|