About 2-fluoropentane
2-fluoropentane (PubChem CID 13299938) has the molecular formula C5H11F
and a molecular weight of 90.14 g/mol. Its IUPAC name is 2-fluoropentane.
Molecular Properties
| Compound Name | 2-fluoropentane |
| PubChem CID | 13299938 |
| Molecular Formula | C5H11F |
| Molecular Weight | 90.14 g/mol |
| Exact Mass | 90.08 |
| IUPAC Name | 2-fluoropentane |
| SMILES | CCCC(C)F |
| InChI | InChI=1S/C5H11F/c1-3-4-5(2)6/h5H,3-4H2,1-2H3 |
| InChIKey | YHRLGIPTCSGMRF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-fluoropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoropentane?
The IUPAC name of 2-fluoropentane (CID 13299938) is 2-fluoropentane.
What is the SMILES notation for 2-fluoropentane?
The canonical SMILES for 2-fluoropentane is CCCC(C)F.
What is the InChIKey of 2-fluoropentane?
The InChIKey is YHRLGIPTCSGMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11F/c1-3-4-5(2)6/h5H,3-4H2,1-2H3.
What are the key properties of 2-fluoropentane?
2-fluoropentane has a molecular weight of 90.14 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoropentane is sourced from PubChem (CID 13299938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).