About 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane]
3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane] (PubChem CID 13300112) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane].
Molecular Properties
| Compound Name | 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane] |
| PubChem CID | 13300112 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane] |
| SMILES | C=CC1(OC)OC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C14H20O2/c1-3-13(15-2)14(16-13)11-5-9-4-10(7-11)8-12(14)6-9/h3,9-12H,1,4-8H2,2H3 |
| InChIKey | MWCXYDDWQLGXDJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane]?
The IUPAC name of 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane] (CID 13300112) is 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane].
What is the SMILES notation for 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane]?
The canonical SMILES for 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane] is C=CC1(OC)OC12C1CC3CC(C1)CC2C3.
What is the InChIKey of 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane]?
The InChIKey is MWCXYDDWQLGXDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-3-13(15-2)14(16-13)11-5-9-4-10(7-11)8-12(14)6-9/h3,9-12H,1,4-8H2,2H3.
What are the key properties of 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane]?
3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane] has a molecular weight of 220.31 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-ethenyl-3'-methoxyspiro[adamantane-2,2'-oxirane] is sourced from PubChem (CID 13300112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).