C5ClF11 — CID 13300297
1-chloro-1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane (PubChem CID 13300297) has the molecular formula C5ClF11 and a molecular weight of 304.49 g/mol. Its IUPAC name is 1-chloro-1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane.
| Compound Name | 1-chloro-1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane |
|---|---|
| PubChem CID | 13300297 |
| Molecular Formula | C5ClF11 |
| Molecular Weight | 304.49 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | 1-chloro-1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C5ClF11/c6-4(13,14)2(9,10)1(7,8)3(11,12)5(15,16)17 |
| InChIKey | TWPDOWXLJAQWJW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|