About cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate
cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 1330031) has the molecular formula C23H23NO4
and a molecular weight of 377.44 g/mol. Its IUPAC name is cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
Molecular Properties
| Compound Name | cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| PubChem CID | 1330031 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | O=C(C[C@@H](c1ccccc1)N1C(=O)c2ccccc2C1=O)OC1CCCCC1 |
| InChI | InChI=1S/C23H23NO4/c25-21(28-17-11-5-2-6-12-17)15-20(16-9-3-1-4-10-16)24-22(26)18-13-7-8-14-19(18)23(24)27/h1,3-4,7-10,13-14,17,20H,2,5-6,11-12,15H2/t20-/m0/s1 |
| InChIKey | PTPWCGYOZJYMKJ-FQEVSTJZSA-N |
| XLogP | 4.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
The IUPAC name of cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (CID 1330031) is cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
What is the SMILES notation for cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
The canonical SMILES for cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate is O=C(C[C@@H](c1ccccc1)N1C(=O)c2ccccc2C1=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
The InChIKey is PTPWCGYOZJYMKJ-FQEVSTJZSA-N. The full InChI is InChI=1S/C23H23NO4/c25-21(28-17-11-5-2-6-12-17)15-20(16-9-3-1-4-10-16)24-22(26)18-13-7-8-14-19(18)23(24)27/h1,3-4,7-10,13-14,17,20H,2,5-6,11-12,15H2/t20-/m0/s1.
What are the key properties of cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate has a molecular weight of 377.44 g/mol, XLogP of 4.29, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl (3S)-3-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate is sourced from PubChem (CID 1330031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).