About methyl N'-ethylcarbamimidothioate
methyl N'-ethylcarbamimidothioate (PubChem CID 13301348) has the molecular formula C4H10N2S
and a molecular weight of 118.20 g/mol. Its IUPAC name is methyl N'-ethylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-ethylcarbamimidothioate |
| PubChem CID | 13301348 |
| Molecular Formula | C4H10N2S |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | methyl N'-ethylcarbamimidothioate |
| SMILES | CC/N=C(/N)SC |
| InChI | InChI=1S/C4H10N2S/c1-3-6-4(5)7-2/h3H2,1-2H3,(H2,5,6) |
| InChIKey | HRDFVQLHRAQAKQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-ethylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-ethylcarbamimidothioate?
The IUPAC name of methyl N'-ethylcarbamimidothioate (CID 13301348) is methyl N'-ethylcarbamimidothioate.
What is the SMILES notation for methyl N'-ethylcarbamimidothioate?
The canonical SMILES for methyl N'-ethylcarbamimidothioate is CC/N=C(/N)SC.
What is the InChIKey of methyl N'-ethylcarbamimidothioate?
The InChIKey is HRDFVQLHRAQAKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2S/c1-3-6-4(5)7-2/h3H2,1-2H3,(H2,5,6).
What are the key properties of methyl N'-ethylcarbamimidothioate?
methyl N'-ethylcarbamimidothioate has a molecular weight of 118.20 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-ethylcarbamimidothioate is sourced from PubChem (CID 13301348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).