About 5-bromo-2-methyl-2,3-dihydro-1-benzofuran
5-bromo-2-methyl-2,3-dihydro-1-benzofuran (PubChem CID 13301601) has the molecular formula C9H9BrO
and a molecular weight of 213.07 g/mol. Its IUPAC name is 5-bromo-2-methyl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 5-bromo-2-methyl-2,3-dihydro-1-benzofuran |
| PubChem CID | 13301601 |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 5-bromo-2-methyl-2,3-dihydro-1-benzofuran |
| SMILES | CC1Cc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C9H9BrO/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-3,5-6H,4H2,1H3 |
| InChIKey | FEPPMMHYULGHKP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2-methyl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methyl-2,3-dihydro-1-benzofuran?
The IUPAC name of 5-bromo-2-methyl-2,3-dihydro-1-benzofuran (CID 13301601) is 5-bromo-2-methyl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 5-bromo-2-methyl-2,3-dihydro-1-benzofuran?
The canonical SMILES for 5-bromo-2-methyl-2,3-dihydro-1-benzofuran is CC1Cc2cc(Br)ccc2O1.
What is the InChIKey of 5-bromo-2-methyl-2,3-dihydro-1-benzofuran?
The InChIKey is FEPPMMHYULGHKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-3,5-6H,4H2,1H3.
What are the key properties of 5-bromo-2-methyl-2,3-dihydro-1-benzofuran?
5-bromo-2-methyl-2,3-dihydro-1-benzofuran has a molecular weight of 213.07 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methyl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 13301601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).