About 2-methoxypyrimidin-5-ol
2-methoxypyrimidin-5-ol (PubChem CID 13302366) has the molecular formula C5H6N2O2
and a molecular weight of 126.11 g/mol. Its IUPAC name is 2-methoxypyrimidin-5-ol.
Molecular Properties
| Compound Name | 2-methoxypyrimidin-5-ol |
| PubChem CID | 13302366 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | 2-methoxypyrimidin-5-ol |
| SMILES | COc1ncc(O)cn1 |
| InChI | InChI=1S/C5H6N2O2/c1-9-5-6-2-4(8)3-7-5/h2-3,8H,1H3 |
| InChIKey | PCZQRJXEHGOEJL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxypyrimidin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypyrimidin-5-ol?
The IUPAC name of 2-methoxypyrimidin-5-ol (CID 13302366) is 2-methoxypyrimidin-5-ol.
What is the SMILES notation for 2-methoxypyrimidin-5-ol?
The canonical SMILES for 2-methoxypyrimidin-5-ol is COc1ncc(O)cn1.
What is the InChIKey of 2-methoxypyrimidin-5-ol?
The InChIKey is PCZQRJXEHGOEJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2/c1-9-5-6-2-4(8)3-7-5/h2-3,8H,1H3.
What are the key properties of 2-methoxypyrimidin-5-ol?
2-methoxypyrimidin-5-ol has a molecular weight of 126.11 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypyrimidin-5-ol is sourced from PubChem (CID 13302366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).