C9H12N2 — CID 13302397
5,6,7,8-tetrahydroisoquinolin-3-amine (PubChem CID 13302397) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroisoquinolin-3-amine.
| Compound Name | 5,6,7,8-tetrahydroisoquinolin-3-amine |
|---|---|
| PubChem CID | 13302397 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 5,6,7,8-tetrahydroisoquinolin-3-amine |
| SMILES | Nc1cc2c(cn1)CCCC2 |
| InChI | InChI=1S/C9H12N2/c10-9-5-7-3-1-2-4-8(7)6-11-9/h5-6H,1-4H2,(H2,10,11) |
| InChIKey | PQJSKRANCYSNLG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |