About triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane
triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane (PubChem CID 13302584) has the molecular formula C10H23GeNO2S
and a molecular weight of 293.98 g/mol. Its IUPAC name is triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane.
Molecular Properties
| Compound Name | triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane |
| PubChem CID | 13302584 |
| Molecular Formula | C10H23GeNO2S |
| Molecular Weight | 293.98 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane |
| SMILES | CC[Ge](CC)(CC)C1CCN(C)S1(=O)=O |
| InChI | InChI=1S/C10H23GeNO2S/c1-5-11(6-2,7-3)10-8-9-12(4)15(10,13)14/h10H,5-9H2,1-4H3 |
| InChIKey | VKAWOLGYVPHLKI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.98 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane?
The IUPAC name of triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane (CID 13302584) is triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane.
What is the SMILES notation for triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane?
The canonical SMILES for triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane is CC[Ge](CC)(CC)C1CCN(C)S1(=O)=O.
What is the InChIKey of triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane?
The InChIKey is VKAWOLGYVPHLKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23GeNO2S/c1-5-11(6-2,7-3)10-8-9-12(4)15(10,13)14/h10H,5-9H2,1-4H3.
What are the key properties of triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane?
triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane has a molecular weight of 293.98 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-(2-methyl-1,1-dioxo-1,2-thiazolidin-5-yl)germane is sourced from PubChem (CID 13302584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).