C10H5F9O3S — CID 13302824
1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-phenylethoxy)ethanesulfonyl fluoride (PubChem CID 13302824) has the molecular formula C10H5F9O3S and a molecular weight of 376.20 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-phenylethoxy)ethanesulfonyl fluoride.
| Compound Name | 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-phenylethoxy)ethanesulfonyl fluoride |
|---|---|
| PubChem CID | 13302824 |
| Molecular Formula | C10H5F9O3S |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-phenylethoxy)ethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C10H5F9O3S/c11-7(12,6-4-2-1-3-5-6)8(13,14)22-9(15,16)10(17,18)23(19,20)21/h1-5H |
| InChIKey | YOEBEQZIOGNPPF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|