About (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one
(5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one (PubChem CID 13303059) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one.
Molecular Properties
| Compound Name | (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one |
| PubChem CID | 13303059 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one |
| SMILES | Cn1ncc2c1CC/C(=C\O)C2=O |
| InChI | InChI=1S/C9H10N2O2/c1-11-8-3-2-6(5-12)9(13)7(8)4-10-11/h4-5,12H,2-3H2,1H3/b6-5+ |
| InChIKey | LMBRQOLJOSJKNC-AATRIKPKSA-N |
| XLogP | 0.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one?
The IUPAC name of (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one (CID 13303059) is (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one.
What is the SMILES notation for (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one?
The canonical SMILES for (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one is Cn1ncc2c1CC/C(=C\O)C2=O.
What is the InChIKey of (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one?
The InChIKey is LMBRQOLJOSJKNC-AATRIKPKSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-11-8-3-2-6(5-12)9(13)7(8)4-10-11/h4-5,12H,2-3H2,1H3/b6-5+.
What are the key properties of (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one?
(5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one has a molecular weight of 178.19 g/mol, XLogP of 0.99, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-(hydroxymethylidene)-1-methyl-6,7-dihydroindazol-4-one is sourced from PubChem (CID 13303059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).