C32H22O3 — CID 13303255
3-hydroxy-4,5,6,7-tetraphenyl-3H-2-benzofuran-1-one (PubChem CID 13303255) has the molecular formula C32H22O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-hydroxy-4,5,6,7-tetraphenyl-3H-2-benzofuran-1-one.
| Compound Name | 3-hydroxy-4,5,6,7-tetraphenyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 13303255 |
| Molecular Formula | C32H22O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 3-hydroxy-4,5,6,7-tetraphenyl-3H-2-benzofuran-1-one |
| SMILES | O=C1OC(O)c2c1c(-c1ccccc1)c(-c1ccccc1)c(-c1ccccc1)c2-c1ccccc1 |
| InChI | InChI=1S/C32H22O3/c33-31-29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(30(29)32(34)35-31)24-19-11-4-12-20-24/h1-20,31,33H |
| InChIKey | CUPYCLCYNVELBJ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |