About (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane
(3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane (PubChem CID 13303645) has the molecular formula C11H24Si2
and a molecular weight of 212.48 g/mol. Its IUPAC name is (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane.
Molecular Properties
| Compound Name | (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane |
| PubChem CID | 13303645 |
| Molecular Formula | C11H24Si2 |
| Molecular Weight | 212.48 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane |
| SMILES | CC(C)(C)C1=C([Si](C)(C)C)[Si]1(C)C |
| InChI | InChI=1S/C11H24Si2/c1-11(2,3)9-10(12(4,5)6)13(9,7)8/h1-8H3 |
| InChIKey | RJYOIQJHXWHAHA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane?
The IUPAC name of (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane (CID 13303645) is (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane.
What is the SMILES notation for (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane?
The canonical SMILES for (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane is CC(C)(C)C1=C([Si](C)(C)C)[Si]1(C)C.
What is the InChIKey of (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane?
The InChIKey is RJYOIQJHXWHAHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24Si2/c1-11(2,3)9-10(12(4,5)6)13(9,7)8/h1-8H3.
What are the key properties of (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane?
(3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane has a molecular weight of 212.48 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-tert-butyl-1,1-dimethylsiliren-2-yl)-trimethylsilane is sourced from PubChem (CID 13303645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).