About 2-tert-butyl-1,1,3-trimethylsilirene
2-tert-butyl-1,1,3-trimethylsilirene (PubChem CID 13303646) has the molecular formula C9H18Si
and a molecular weight of 154.33 g/mol. Its IUPAC name is 2-tert-butyl-1,1,3-trimethylsilirene.
Molecular Properties
| Compound Name | 2-tert-butyl-1,1,3-trimethylsilirene |
| PubChem CID | 13303646 |
| Molecular Formula | C9H18Si |
| Molecular Weight | 154.33 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 2-tert-butyl-1,1,3-trimethylsilirene |
| SMILES | CC1=C(C(C)(C)C)[Si]1(C)C |
| InChI | InChI=1S/C9H18Si/c1-7-8(9(2,3)4)10(7,5)6/h1-6H3 |
| InChIKey | WFKNHXAAGXRYHB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-1,1,3-trimethylsilirene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,1,3-trimethylsilirene?
The IUPAC name of 2-tert-butyl-1,1,3-trimethylsilirene (CID 13303646) is 2-tert-butyl-1,1,3-trimethylsilirene.
What is the SMILES notation for 2-tert-butyl-1,1,3-trimethylsilirene?
The canonical SMILES for 2-tert-butyl-1,1,3-trimethylsilirene is CC1=C(C(C)(C)C)[Si]1(C)C.
What is the InChIKey of 2-tert-butyl-1,1,3-trimethylsilirene?
The InChIKey is WFKNHXAAGXRYHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18Si/c1-7-8(9(2,3)4)10(7,5)6/h1-6H3.
What are the key properties of 2-tert-butyl-1,1,3-trimethylsilirene?
2-tert-butyl-1,1,3-trimethylsilirene has a molecular weight of 154.33 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,1,3-trimethylsilirene is sourced from PubChem (CID 13303646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).