C11HF9N2 — CID 13303728
2,3,5,6-tetrafluoro-N-(2,3,4,5,6-pentafluorophenyl)pyridin-4-amine (PubChem CID 13303728) has the molecular formula C11HF9N2 and a molecular weight of 332.13 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(2,3,4,5,6-pentafluorophenyl)pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-(2,3,4,5,6-pentafluorophenyl)pyridin-4-amine |
|---|---|
| PubChem CID | 13303728 |
| Molecular Formula | C11HF9N2 |
| Molecular Weight | 332.13 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(2,3,4,5,6-pentafluorophenyl)pyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(Nc2c(F)c(F)c(F)c(F)c2F)c1F |
| InChI | InChI=1S/C11HF9N2/c12-1-2(13)4(15)8(5(16)3(1)14)21-9-6(17)10(19)22-11(20)7(9)18/h(H,21,22) |
| InChIKey | MUCHZIMFEUBANQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.13 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|