C18H26N4O3 — CID 13304715
1-[2-hydroxy-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 13304715) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-hydroxy-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 13304715 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[2-hydroxy-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1(C)CC(=O)N(CC(O)CN2CCN(c3ccccn3)CC2)C1=O |
| InChI | InChI=1S/C18H26N4O3/c1-18(2)11-16(24)22(17(18)25)13-14(23)12-20-7-9-21(10-8-20)15-5-3-4-6-19-15/h3-6,14,23H,7-13H2,1-2H3 |
| InChIKey | GLPCPWAFUOAYIC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|