C31H47ClN8O9 — CID 133052630
5-chloro-15-hydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylhepta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone (PubChem CID 133052630) has the molecular formula C31H47ClN8O9 and a molecular weight of 711.22 g/mol. Its IUPAC name is 5-chloro-15-hydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylhepta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone.
| Compound Name | 5-chloro-15-hydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylhepta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone |
|---|---|
| PubChem CID | 133052630 |
| Molecular Formula | C31H47ClN8O9 |
| Molecular Weight | 711.22 g/mol |
| Exact Mass | 710.32 |
| IUPAC Name | 5-chloro-15-hydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylhepta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone |
| SMILES | CC(C)C=CC=CCC1NC(=O)C2CC(O)CNN2C(=O)COC(=O)C(C)(CO)NC(=O)C2CCCNN2C(=O)C2CC(Cl)CNN2C1=O |
| InChI | InChI=1S/C31H47ClN8O9/c1-18(2)8-5-4-6-9-21-28(46)40-24(12-19(32)14-34-40)29(47)39-22(10-7-11-33-39)27(45)37-31(3,17-41)30(48)49-16-25(43)38-23(26(44)36-21)13-20(42)15-35-38/h4-6,8,18-24,33-35,41-42H,7,9-17H2,1-3H3,(H,36,44)(H,37,45) |
| InChIKey | JQWUSEVRGIXWTP-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 221.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.22 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|