C47H79O14P — CID 133053312
[3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-2-[13-(3-pent-2-enyloxiran-2-yl)trideca-5,8,11-trienoyloxy]propyl] octadec-9-enoate (PubChem CID 133053312) has the molecular formula C47H79O14P and a molecular weight of 899.11 g/mol. Its IUPAC name is [3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-2-[13-(3-pent-2-enyloxiran-2-yl)trideca-5,8,11-trienoyloxy]propyl] octadec-9-enoate.
| Compound Name | [3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-2-[13-(3-pent-2-enyloxiran-2-yl)trideca-5,8,11-trienoyloxy]propyl] octadec-9-enoate |
|---|---|
| PubChem CID | 133053312 |
| Molecular Formula | C47H79O14P |
| Molecular Weight | 899.11 g/mol |
| Exact Mass | 898.52 |
| IUPAC Name | [3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-2-[13-(3-pent-2-enyloxiran-2-yl)trideca-5,8,11-trienoyloxy]propyl] octadec-9-enoate |
| SMILES | CCC=CCC1OC1CC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C47H79O14P/c1-3-5-7-8-9-10-11-12-13-14-15-19-22-25-29-33-40(48)57-35-37(36-58-62(55,56)61-47-45(53)43(51)42(50)44(52)46(47)54)59-41(49)34-30-26-23-20-17-16-18-21-24-28-32-39-38(60-39)31-27-6-4-2/h6,12-13,16,18,20,23-24,27-28,37-39,42-47,50-54H,3-5,7-11,14-15,17,19,21-22,25-26,29-36H2,1-2H3,(H,55,56) |
| InChIKey | SNHAGAJOXHXJQA-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 222.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 62 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.11 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|