C40H76O2 — CID 133053545
(1S,4R,5R)-4-[(E,3R,7S,12S,16S)-18-[(1R,4R,5S)-4-hydroxy-2,2,5-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadec-13-enyl]-3,3,5-trimethylcyclohexan-1-ol (PubChem CID 133053545) has the molecular formula C40H76O2 and a molecular weight of 589.05 g/mol. Its IUPAC name is (1S,4R,5R)-4-[(E,3R,7S,12S,16S)-18-[(1R,4R,5S)-4-hydroxy-2,2,5-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadec-13-enyl]-3,3,5-trimethylcyclohexan-1-ol.
| Compound Name | (1S,4R,5R)-4-[(E,3R,7S,12S,16S)-18-[(1R,4R,5S)-4-hydroxy-2,2,5-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadec-13-enyl]-3,3,5-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 133053545 |
| Molecular Formula | C40H76O2 |
| Molecular Weight | 589.05 g/mol |
| Exact Mass | 588.58 |
| IUPAC Name | (1S,4R,5R)-4-[(E,3R,7S,12S,16S)-18-[(1R,4R,5S)-4-hydroxy-2,2,5-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadec-13-enyl]-3,3,5-trimethylcyclohexan-1-ol |
| SMILES | C[C@@H](CCCC[C@H](C)/C=C/C[C@@H](C)CC[C@@H]1C[C@H](C)[C@H](O)CC1(C)C)CCC[C@@H](C)CC[C@@H]1[C@H](C)C[C@H](O)CC1(C)C |
| InChI | InChI=1S/C40H76O2/c1-29(17-13-19-31(3)21-23-35-25-34(6)38(42)28-39(35,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-37-33(5)26-36(41)27-40(37,9)10/h13,17,29-38,41-42H,11-12,14-16,18-28H2,1-10H3/b17-13+/t29-,30-,31+,32+,33+,34-,35+,36-,37+,38+/m0/s1 |
| InChIKey | YPZZUOAQONXVNA-XBGBPSKVSA-N |
| XLogP | 11.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.05 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|