C18H20N4O — CID 133053823
(4S)-4-methyl-6-(1-pent-4-ynylpyrazol-4-yl)-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (PubChem CID 133053823) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is (4S)-4-methyl-6-(1-pent-4-ynylpyrazol-4-yl)-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one.
| Compound Name | (4S)-4-methyl-6-(1-pent-4-ynylpyrazol-4-yl)-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 133053823 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (4S)-4-methyl-6-(1-pent-4-ynylpyrazol-4-yl)-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| SMILES | C#CCCCn1cc(-c2cccc3c2N[C@@H](C)CC(=O)N3)cn1 |
| InChI | InChI=1S/C18H20N4O/c1-3-4-5-9-22-12-14(11-19-22)15-7-6-8-16-18(15)20-13(2)10-17(23)21-16/h1,6-8,11-13,20H,4-5,9-10H2,2H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | KECCNXKPEVUXHJ-ZDUSSCGKSA-N |
| XLogP | 3.11 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|