C15H22O4 — CID 133053862
2-(5,9a-dimethyl-2-oxo-3,4,4a,5,6,7,8,9-octahydrocyclohepta[b]pyran-8-yl)prop-2-enoic acid (PubChem CID 133053862) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-(5,9a-dimethyl-2-oxo-3,4,4a,5,6,7,8,9-octahydrocyclohepta[b]pyran-8-yl)prop-2-enoic acid.
| Compound Name | 2-(5,9a-dimethyl-2-oxo-3,4,4a,5,6,7,8,9-octahydrocyclohepta[b]pyran-8-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 133053862 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-(5,9a-dimethyl-2-oxo-3,4,4a,5,6,7,8,9-octahydrocyclohepta[b]pyran-8-yl)prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1CCC(C)C2CCC(=O)OC2(C)C1 |
| InChI | InChI=1S/C15H22O4/c1-9-4-5-11(10(2)14(17)18)8-15(3)12(9)6-7-13(16)19-15/h9,11-12H,2,4-8H2,1,3H3,(H,17,18) |
| InChIKey | PFEDOONBTJJKHZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|