C47H38O4Se2Si — CID 133053908
15,16-dimethoxy-22-(4-methoxyphenyl)-20,21-bis(phenylselanyl)-11-trimethylsilylhexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3,5,7,11,13,15,17,19,21-undecaen-9-one (PubChem CID 133053908) has the molecular formula C47H38O4Se2Si and a molecular weight of 852.82 g/mol. Its IUPAC name is 15,16-dimethoxy-22-(4-methoxyphenyl)-20,21-bis(phenylselanyl)-11-trimethylsilylhexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3,5,7,11,13,15,17,19,21-undecaen-9-one.
| Compound Name | 15,16-dimethoxy-22-(4-methoxyphenyl)-20,21-bis(phenylselanyl)-11-trimethylsilylhexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3,5,7,11,13,15,17,19,21-undecaen-9-one |
|---|---|
| PubChem CID | 133053908 |
| Molecular Formula | C47H38O4Se2Si |
| Molecular Weight | 852.82 g/mol |
| Exact Mass | 854.09 |
| IUPAC Name | 15,16-dimethoxy-22-(4-methoxyphenyl)-20,21-bis(phenylselanyl)-11-trimethylsilylhexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3,5,7,11,13,15,17,19,21-undecaen-9-one |
| SMILES | COc1ccc(-c2c([Se]c3ccccc3)c([Se]c3ccccc3)c3c4c(c([Si](C)(C)C)c5c(c24)-c2ccccc2C5=O)-c2cc(OC)c(OC)cc2-3)cc1 |
| InChI | InChI=1S/C47H38O4Se2Si/c1-49-28-23-21-27(22-24-28)37-41-38-31-19-13-14-20-32(31)44(48)43(38)47(54(4,5)6)40-34-26-36(51-3)35(50-2)25-33(34)39(42(40)41)46(53-30-17-11-8-12-18-30)45(37)52-29-15-9-7-10-16-29/h7-26H,1-6H3 |
| InChIKey | IJXCWIJNSXXMBD-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.82 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|