C35H30O4Si — CID 133053930
15,16-dimethoxy-22-(4-methoxyphenyl)-11-trimethylsilylhexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(22),2(10),3,5,7,11,13,15,17,19(23),20-undecaen-9-one (PubChem CID 133053930) has the molecular formula C35H30O4Si and a molecular weight of 542.71 g/mol. Its IUPAC name is 15,16-dimethoxy-22-(4-methoxyphenyl)-11-trimethylsilylhexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(22),2(10),3,5,7,11,13,15,17,19(23),20-undecaen-9-one.
| Compound Name | 15,16-dimethoxy-22-(4-methoxyphenyl)-11-trimethylsilylhexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(22),2(10),3,5,7,11,13,15,17,19(23),20-undecaen-9-one |
|---|---|
| PubChem CID | 133053930 |
| Molecular Formula | C35H30O4Si |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 15,16-dimethoxy-22-(4-methoxyphenyl)-11-trimethylsilylhexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(22),2(10),3,5,7,11,13,15,17,19(23),20-undecaen-9-one |
| SMILES | COc1ccc(-c2ccc3c4c(c([Si](C)(C)C)c5c(c24)-c2ccccc2C5=O)-c2cc(OC)c(OC)cc2-3)cc1 |
| InChI | InChI=1S/C35H30O4Si/c1-37-20-13-11-19(12-14-20)21-15-16-23-25-17-27(38-2)28(39-3)18-26(25)32-30(23)29(21)31-22-9-7-8-10-24(22)34(36)33(31)35(32)40(4,5)6/h7-18H,1-6H3 |
| InChIKey | CQCCPCZEBBGVKM-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|