About 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride
2,5-diamino-1H-pyrimidin-6-one;dihydrochloride (PubChem CID 133054025) has the molecular formula C4H8Cl2N4O
and a molecular weight of 199.04 g/mol. Its IUPAC name is 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride.
Molecular Properties
| Compound Name | 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride |
| PubChem CID | 133054025 |
| Molecular Formula | C4H8Cl2N4O |
| Molecular Weight | 199.04 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride |
| SMILES | Cl.Cl.Nc1ncc(N)c(=O)[nH]1 |
| InChI | InChI=1S/C4H6N4O.2ClH/c5-2-1-7-4(6)8-3(2)9;;/h1H,5H2,(H3,6,7,8,9);2*1H |
| InChIKey | QDRTYFMBPDNRMK-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.04 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride?
The IUPAC name of 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride (CID 133054025) is 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride.
What is the SMILES notation for 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride?
The canonical SMILES for 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride is Cl.Cl.Nc1ncc(N)c(=O)[nH]1.
What is the InChIKey of 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride?
The InChIKey is QDRTYFMBPDNRMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O.2ClH/c5-2-1-7-4(6)8-3(2)9;;/h1H,5H2,(H3,6,7,8,9);2*1H.
What are the key properties of 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride?
2,5-diamino-1H-pyrimidin-6-one;dihydrochloride has a molecular weight of 199.04 g/mol, XLogP of -0.22, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diamino-1H-pyrimidin-6-one;dihydrochloride is sourced from PubChem (CID 133054025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).