C7H9ClN2O2S — CID 133054056
2,2-dioxo-1,3-dihydro-2,1-benzothiazol-5-amine;hydrochloride (PubChem CID 133054056) has the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. Its IUPAC name is 2,2-dioxo-1,3-dihydro-2,1-benzothiazol-5-amine;hydrochloride.
| Compound Name | 2,2-dioxo-1,3-dihydro-2,1-benzothiazol-5-amine;hydrochloride |
|---|---|
| PubChem CID | 133054056 |
| Molecular Formula | C7H9ClN2O2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 2,2-dioxo-1,3-dihydro-2,1-benzothiazol-5-amine;hydrochloride |
| SMILES | Cl.Nc1ccc2c(c1)CS(=O)(=O)N2 |
| InChI | InChI=1S/C7H8N2O2S.ClH/c8-6-1-2-7-5(3-6)4-12(10,11)9-7;/h1-3,9H,4,8H2;1H |
| InChIKey | VEFICJDHFPPYJL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|