About 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one
8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one (PubChem CID 133054201) has the molecular formula C11H12BrNO
and a molecular weight of 254.13 g/mol. Its IUPAC name is 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one.
Molecular Properties
| Compound Name | 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one |
| PubChem CID | 133054201 |
| Molecular Formula | C11H12BrNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one |
| SMILES | CC1(C)CNC(=O)c2c(Br)cccc21 |
| InChI | InChI=1S/C11H12BrNO/c1-11(2)6-13-10(14)9-7(11)4-3-5-8(9)12/h3-5H,6H2,1-2H3,(H,13,14) |
| InChIKey | WSICFDXBJWLZSH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one?
The IUPAC name of 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one (CID 133054201) is 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one.
What is the SMILES notation for 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one?
The canonical SMILES for 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one is CC1(C)CNC(=O)c2c(Br)cccc21.
What is the InChIKey of 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one?
The InChIKey is WSICFDXBJWLZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrNO/c1-11(2)6-13-10(14)9-7(11)4-3-5-8(9)12/h3-5H,6H2,1-2H3,(H,13,14).
What are the key properties of 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one?
8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one has a molecular weight of 254.13 g/mol, XLogP of 2.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one is sourced from PubChem (CID 133054201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).