C10H11Br2N — CID 133054244
6-bromo-3-(bromomethyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 133054244) has the molecular formula C10H11Br2N and a molecular weight of 305.01 g/mol. Its IUPAC name is 6-bromo-3-(bromomethyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-bromo-3-(bromomethyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 133054244 |
| Molecular Formula | C10H11Br2N |
| Molecular Weight | 305.01 g/mol |
| Exact Mass | 302.93 |
| IUPAC Name | 6-bromo-3-(bromomethyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | BrCC1Cc2cc(Br)ccc2CN1 |
| InChI | InChI=1S/C10H11Br2N/c11-5-10-4-8-3-9(12)2-1-7(8)6-13-10/h1-3,10,13H,4-6H2 |
| InChIKey | JVPFRLHXLBXYQB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.01 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|