propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate

C11H15BrN2O2 — CID 133054467

IUPACpropan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate
SMILESCC(C)OC(=O)c1cc(Br)cnc1N(C)C
InChIInChI=1S/C11H15BrN2O2/c1-7(2)16-11(15)9-5-8(12)6-13-10(9)14(3)4/h5-7H,1-4H3
InChIKeyCKAZQRVVSBRRBZ-UHFFFAOYSA-N
MW287.16 g/mol
LogP2.48
Rot. Bonds3

About propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate

propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate (PubChem CID 133054467) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate.

Molecular Properties

Compound Namepropan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate
PubChem CID133054467
Molecular FormulaC11H15BrN2O2
Molecular Weight287.16 g/mol
Exact Mass286.03
IUPAC Namepropan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate
SMILESCC(C)OC(=O)c1cc(Br)cnc1N(C)C
InChIInChI=1S/C11H15BrN2O2/c1-7(2)16-11(15)9-5-8(12)6-13-10(9)14(3)4/h5-7H,1-4H3
InChIKeyCKAZQRVVSBRRBZ-UHFFFAOYSA-N
XLogP2.48
TPSA42.43 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.16
LogP ≤ 52.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate?
The IUPAC name of propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate (CID 133054467) is propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate.
What is the SMILES notation for propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate?
The canonical SMILES for propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate is CC(C)OC(=O)c1cc(Br)cnc1N(C)C.
What is the InChIKey of propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate?
The InChIKey is CKAZQRVVSBRRBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2O2/c1-7(2)16-11(15)9-5-8(12)6-13-10(9)14(3)4/h5-7H,1-4H3.
What are the key properties of propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate?
propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate has a molecular weight of 287.16 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 5-bromo-2-(dimethylamino)pyridine-3-carboxylate is sourced from PubChem (CID 133054467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).