C13H18ClFN2 — CID 133054473
11-fluoro-2-methyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride (PubChem CID 133054473) has the molecular formula C13H18ClFN2 and a molecular weight of 256.75 g/mol. Its IUPAC name is 11-fluoro-2-methyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride.
| Compound Name | 11-fluoro-2-methyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 133054473 |
| Molecular Formula | C13H18ClFN2 |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 11-fluoro-2-methyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride |
| SMILES | CN1CCN2CCc3cccc(F)c3C2C1.Cl |
| InChI | InChI=1S/C13H17FN2.ClH/c1-15-7-8-16-6-5-10-3-2-4-11(14)13(10)12(16)9-15;/h2-4,12H,5-9H2,1H3;1H |
| InChIKey | APZNLTDOQLWVHL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |