About tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate
tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 133056061) has the molecular formula C14H13BrFNO2S
and a molecular weight of 358.23 g/mol. Its IUPAC name is tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 133056061 |
| Molecular Formula | C14H13BrFNO2S |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1nc(Br)sc1-c1ccccc1F |
| InChI | InChI=1S/C14H13BrFNO2S/c1-14(2,3)19-12(18)10-11(20-13(15)17-10)8-6-4-5-7-9(8)16/h4-7H,1-3H3 |
| InChIKey | NDQXXTVUKSUHSV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate (CID 133056061) is tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate is CC(C)(C)OC(=O)c1nc(Br)sc1-c1ccccc1F.
What is the InChIKey of tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate?
The InChIKey is NDQXXTVUKSUHSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrFNO2S/c1-14(2,3)19-12(18)10-11(20-13(15)17-10)8-6-4-5-7-9(8)16/h4-7H,1-3H3.
What are the key properties of tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate?
tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate has a molecular weight of 358.23 g/mol, XLogP of 4.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-bromo-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 133056061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).