About 4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine
4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine (PubChem CID 133056624) has the molecular formula C11H14ClN
and a molecular weight of 195.69 g/mol. Its IUPAC name is 4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine.
Analyze 4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine?
The IUPAC name of 4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine (CID 133056624) is 4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine.
What is the SMILES notation for 4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine?
The canonical SMILES for 4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine is Clc1ccnc2c1CCCCCC2.
What is the InChIKey of 4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine?
The InChIKey is VPHNONLIZCUUSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN/c12-10-7-8-13-11-6-4-2-1-3-5-9(10)11/h7-8H,1-6H2.
What are the key properties of 4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine?
4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine has a molecular weight of 195.69 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine is sourced from PubChem (CID 133056624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).