About 2-acetylthieno[2,3-b]thiophene-5-carboxamide
2-acetylthieno[2,3-b]thiophene-5-carboxamide (PubChem CID 133056845) has the molecular formula C9H7NO2S2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-acetylthieno[2,3-b]thiophene-5-carboxamide.
Molecular Properties
| Compound Name | 2-acetylthieno[2,3-b]thiophene-5-carboxamide |
| PubChem CID | 133056845 |
| Molecular Formula | C9H7NO2S2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 2-acetylthieno[2,3-b]thiophene-5-carboxamide |
| SMILES | CC(=O)c1cc2cc(C(N)=O)sc2s1 |
| InChI | InChI=1S/C9H7NO2S2/c1-4(11)6-2-5-3-7(8(10)12)14-9(5)13-6/h2-3H,1H3,(H2,10,12) |
| InChIKey | QKPQXXOWCOUBHI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-acetylthieno[2,3-b]thiophene-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetylthieno[2,3-b]thiophene-5-carboxamide?
The IUPAC name of 2-acetylthieno[2,3-b]thiophene-5-carboxamide (CID 133056845) is 2-acetylthieno[2,3-b]thiophene-5-carboxamide.
What is the SMILES notation for 2-acetylthieno[2,3-b]thiophene-5-carboxamide?
The canonical SMILES for 2-acetylthieno[2,3-b]thiophene-5-carboxamide is CC(=O)c1cc2cc(C(N)=O)sc2s1.
What is the InChIKey of 2-acetylthieno[2,3-b]thiophene-5-carboxamide?
The InChIKey is QKPQXXOWCOUBHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2S2/c1-4(11)6-2-5-3-7(8(10)12)14-9(5)13-6/h2-3H,1H3,(H2,10,12).
What are the key properties of 2-acetylthieno[2,3-b]thiophene-5-carboxamide?
2-acetylthieno[2,3-b]thiophene-5-carboxamide has a molecular weight of 225.29 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetylthieno[2,3-b]thiophene-5-carboxamide is sourced from PubChem (CID 133056845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).