About propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate
propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate (PubChem CID 133057217) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate |
| PubChem CID | 133057217 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate |
| SMILES | Cc1nc(C(=O)OC(C)C)cnc1N |
| InChI | InChI=1S/C9H13N3O2/c1-5(2)14-9(13)7-4-11-8(10)6(3)12-7/h4-5H,1-3H3,(H2,10,11) |
| InChIKey | ZFGSFLMVLNUDRP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate?
The IUPAC name of propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate (CID 133057217) is propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate.
What is the SMILES notation for propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate?
The canonical SMILES for propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate is Cc1nc(C(=O)OC(C)C)cnc1N.
What is the InChIKey of propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate?
The InChIKey is ZFGSFLMVLNUDRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-5(2)14-9(13)7-4-11-8(10)6(3)12-7/h4-5H,1-3H3,(H2,10,11).
What are the key properties of propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate?
propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate has a molecular weight of 195.22 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 5-amino-6-methylpyrazine-2-carboxylate is sourced from PubChem (CID 133057217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).