C15H19BN2O3 — CID 133057557
6-cyclopropyloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile (PubChem CID 133057557) has the molecular formula C15H19BN2O3 and a molecular weight of 286.14 g/mol. Its IUPAC name is 6-cyclopropyloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile.
| Compound Name | 6-cyclopropyloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133057557 |
| Molecular Formula | C15H19BN2O3 |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 6-cyclopropyloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile |
| SMILES | CC1(C)OB(c2ccc(OC3CC3)nc2C#N)OC1(C)C |
| InChI | InChI=1S/C15H19BN2O3/c1-14(2)15(3,4)21-16(20-14)11-7-8-13(18-12(11)9-17)19-10-5-6-10/h7-8,10H,5-6H2,1-4H3 |
| InChIKey | BXNLUVHCVVLJID-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|